C18H19Cl2NO3 — CID 170885305
ethyl 2-amino-3-[2-[(2,4-dichlorophenyl)methoxy]phenyl]propanoate (PubChem CID 170885305) has the molecular formula C18H19Cl2NO3 and a molecular weight of 368.26 g/mol. Its IUPAC name is ethyl 2-amino-3-[2-[(2,4-dichlorophenyl)methoxy]phenyl]propanoate.
| Compound Name | ethyl 2-amino-3-[2-[(2,4-dichlorophenyl)methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 170885305 |
| Molecular Formula | C18H19Cl2NO3 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | ethyl 2-amino-3-[2-[(2,4-dichlorophenyl)methoxy]phenyl]propanoate |
| SMILES | CCOC(=O)C(N)Cc1ccccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H19Cl2NO3/c1-2-23-18(22)16(21)9-12-5-3-4-6-17(12)24-11-13-7-8-14(19)10-15(13)20/h3-8,10,16H,2,9,11,21H2,1H3 |
| InChIKey | CZXPVFMRQDWASG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |