C18H18Cl2O4 — CID 139988229
ethyl 3-[2-[(2,4-dichlorophenyl)methoxy]-4-hydroxyphenyl]propanoate (PubChem CID 139988229) has the molecular formula C18H18Cl2O4 and a molecular weight of 369.24 g/mol. Its IUPAC name is ethyl 3-[2-[(2,4-dichlorophenyl)methoxy]-4-hydroxyphenyl]propanoate.
| Compound Name | ethyl 3-[2-[(2,4-dichlorophenyl)methoxy]-4-hydroxyphenyl]propanoate |
|---|---|
| PubChem CID | 139988229 |
| Molecular Formula | C18H18Cl2O4 |
| Molecular Weight | 369.24 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | ethyl 3-[2-[(2,4-dichlorophenyl)methoxy]-4-hydroxyphenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(O)cc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H18Cl2O4/c1-2-23-18(22)8-5-12-4-7-15(21)10-17(12)24-11-13-3-6-14(19)9-16(13)20/h3-4,6-7,9-10,21H,2,5,8,11H2,1H3 |
| InChIKey | SDHPOCKMOJFUCA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.24 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |