C19H22O5 — CID 139988094
ethyl 3-[4-hydroxy-2-[(2-methoxyphenyl)methoxy]phenyl]propanoate (PubChem CID 139988094) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is ethyl 3-[4-hydroxy-2-[(2-methoxyphenyl)methoxy]phenyl]propanoate.
| Compound Name | ethyl 3-[4-hydroxy-2-[(2-methoxyphenyl)methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 139988094 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | ethyl 3-[4-hydroxy-2-[(2-methoxyphenyl)methoxy]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(O)cc1OCc1ccccc1OC |
| InChI | InChI=1S/C19H22O5/c1-3-23-19(21)11-9-14-8-10-16(20)12-18(14)24-13-15-6-4-5-7-17(15)22-2/h4-8,10,12,20H,3,9,11,13H2,1-2H3 |
| InChIKey | VHIKCSYPTAGAOV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |