C14H19Cl2NO3 — CID 62012022
ethyl 3-[2-(2,4-dichlorophenoxy)ethyl-methylamino]propanoate (PubChem CID 62012022) has the molecular formula C14H19Cl2NO3 and a molecular weight of 320.22 g/mol. Its IUPAC name is ethyl 3-[2-(2,4-dichlorophenoxy)ethyl-methylamino]propanoate.
| Compound Name | ethyl 3-[2-(2,4-dichlorophenoxy)ethyl-methylamino]propanoate |
|---|---|
| PubChem CID | 62012022 |
| Molecular Formula | C14H19Cl2NO3 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | ethyl 3-[2-(2,4-dichlorophenoxy)ethyl-methylamino]propanoate |
| SMILES | CCOC(=O)CCN(C)CCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H19Cl2NO3/c1-3-19-14(18)6-7-17(2)8-9-20-13-5-4-11(15)10-12(13)16/h4-5,10H,3,6-9H2,1-2H3 |
| InChIKey | RFCOCJQVUVYPDW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |