C21H21N3O4 — CID 135322262
2-amino-3-[2-[[2-(2-methoxyphenyl)pyrimidin-4-yl]methoxy]phenyl]propanoic acid (PubChem CID 135322262) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 2-amino-3-[2-[[2-(2-methoxyphenyl)pyrimidin-4-yl]methoxy]phenyl]propanoic acid.
| Compound Name | 2-amino-3-[2-[[2-(2-methoxyphenyl)pyrimidin-4-yl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 135322262 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-amino-3-[2-[[2-(2-methoxyphenyl)pyrimidin-4-yl]methoxy]phenyl]propanoic acid |
| SMILES | COc1ccccc1-c1nccc(COc2ccccc2CC(N)C(=O)O)n1 |
| InChI | InChI=1S/C21H21N3O4/c1-27-19-9-5-3-7-16(19)20-23-11-10-15(24-20)13-28-18-8-4-2-6-14(18)12-17(22)21(25)26/h2-11,17H,12-13,22H2,1H3,(H,25,26) |
| InChIKey | QECDIZHSMFZBSB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |