C26H51NOSiSn — CID 171062298
tert-butyl-dimethyl-[(2S)-1-(2-tributylstannyl-4-pyridinyl)propan-2-yl]oxysilane (PubChem CID 171062298) has the molecular formula C26H51NOSiSn and a molecular weight of 540.50 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2S)-1-(2-tributylstannyl-4-pyridinyl)propan-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2S)-1-(2-tributylstannyl-4-pyridinyl)propan-2-yl]oxysilane |
|---|---|
| PubChem CID | 171062298 |
| Molecular Formula | C26H51NOSiSn |
| Molecular Weight | 540.50 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | tert-butyl-dimethyl-[(2S)-1-(2-tributylstannyl-4-pyridinyl)propan-2-yl]oxysilane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cc(C[C@H](C)O[Si](C)(C)C(C)(C)C)ccn1 |
| InChI | InChI=1S/C14H24NOSi.3C4H9.Sn/c1-12(11-13-7-9-15-10-8-13)16-17(5,6)14(2,3)4;3*1-3-4-2;/h7-9,12H,11H2,1-6H3;3*1,3-4H2,2H3;/t12-;;;;/m0..../s1 |
| InChIKey | DDUSTTULUFXOAS-KCOFNFEMSA-N |
| XLogP | 8.09 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.50 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|