C15H25Cl2NO2Si — CID 140893776
tert-butyl-[(1R,2R)-1-(3,5-dichloro-4-pyridinyl)-1-methoxypropan-2-yl]oxy-dimethylsilane (PubChem CID 140893776) has the molecular formula C15H25Cl2NO2Si and a molecular weight of 350.36 g/mol. Its IUPAC name is tert-butyl-[(1R,2R)-1-(3,5-dichloro-4-pyridinyl)-1-methoxypropan-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1R,2R)-1-(3,5-dichloro-4-pyridinyl)-1-methoxypropan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 140893776 |
| Molecular Formula | C15H25Cl2NO2Si |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | tert-butyl-[(1R,2R)-1-(3,5-dichloro-4-pyridinyl)-1-methoxypropan-2-yl]oxy-dimethylsilane |
| SMILES | CO[C@H](c1c(Cl)cncc1Cl)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H25Cl2NO2Si/c1-10(20-21(6,7)15(2,3)4)14(19-5)13-11(16)8-18-9-12(13)17/h8-10,14H,1-7H3/t10-,14+/m1/s1 |
| InChIKey | LGAZGQHNFHGLSD-YGRLFVJLSA-N |
| XLogP | 5.49 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|