C23H30BrN3O2SSi — CID 58015371
N-(5-bromo-[1,3]thiazolo[5,4-b]pyridin-2-yl)-4-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]benzamide (PubChem CID 58015371) has the molecular formula C23H30BrN3O2SSi and a molecular weight of 520.57 g/mol. Its IUPAC name is N-(5-bromo-[1,3]thiazolo[5,4-b]pyridin-2-yl)-4-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]benzamide.
| Compound Name | N-(5-bromo-[1,3]thiazolo[5,4-b]pyridin-2-yl)-4-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 58015371 |
| Molecular Formula | C23H30BrN3O2SSi |
| Molecular Weight | 520.57 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | N-(5-bromo-[1,3]thiazolo[5,4-b]pyridin-2-yl)-4-[1-[tert-butyl(dimethyl)silyl]oxy-2-methylpropan-2-yl]benzamide |
| SMILES | CC(C)(CO[Si](C)(C)C(C)(C)C)c1ccc(C(=O)Nc2nc3ccc(Br)nc3s2)cc1 |
| InChI | InChI=1S/C23H30BrN3O2SSi/c1-22(2,3)31(6,7)29-14-23(4,5)16-10-8-15(9-11-16)19(28)27-21-25-17-12-13-18(24)26-20(17)30-21/h8-13H,14H2,1-7H3,(H,25,27,28) |
| InChIKey | QAPRXHNOZNXUQW-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.57 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|