C14H10BrN3OS — CID 142524471
N-(7-bromo-6-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)benzamide (PubChem CID 142524471) has the molecular formula C14H10BrN3OS and a molecular weight of 348.23 g/mol. Its IUPAC name is N-(7-bromo-6-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)benzamide.
| Compound Name | N-(7-bromo-6-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)benzamide |
|---|---|
| PubChem CID | 142524471 |
| Molecular Formula | C14H10BrN3OS |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 346.97 |
| IUPAC Name | N-(7-bromo-6-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)benzamide |
| SMILES | Cc1ncc2nc(NC(=O)c3ccccc3)sc2c1Br |
| InChI | InChI=1S/C14H10BrN3OS/c1-8-11(15)12-10(7-16-8)17-14(20-12)18-13(19)9-5-3-2-4-6-9/h2-7H,1H3,(H,17,18,19) |
| InChIKey | LHMSWOXWHAPVCF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |