C17H19N3OS — CID 154659407
N-(6,7-dimethyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)benzamide;ethane (PubChem CID 154659407) has the molecular formula C17H19N3OS and a molecular weight of 313.43 g/mol. Its IUPAC name is N-(6,7-dimethyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)benzamide;ethane.
| Compound Name | N-(6,7-dimethyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)benzamide;ethane |
|---|---|
| PubChem CID | 154659407 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-(6,7-dimethyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)benzamide;ethane |
| SMILES | CC.Cc1ncc2nc(NC(=O)c3ccccc3)sc2c1C |
| InChI | InChI=1S/C15H13N3OS.C2H6/c1-9-10(2)16-8-12-13(9)20-15(17-12)18-14(19)11-6-4-3-5-7-11;1-2/h3-8H,1-2H3,(H,17,18,19);1-2H3 |
| InChIKey | KUEIWOILGDSCSO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |