C13H29NO2SSi — CID 90089971
(NE,S)-N-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-ylidene]-2-methylpropane-2-sulfinamide (PubChem CID 90089971) has the molecular formula C13H29NO2SSi and a molecular weight of 291.53 g/mol. Its IUPAC name is (NE,S)-N-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-ylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,S)-N-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-ylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 90089971 |
| Molecular Formula | C13H29NO2SSi |
| Molecular Weight | 291.53 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | (NE,S)-N-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-ylidene]-2-methylpropane-2-sulfinamide |
| SMILES | C/C(CO[Si](C)(C)C(C)(C)C)=N\[S@@](=O)C(C)(C)C |
| InChI | InChI=1S/C13H29NO2SSi/c1-11(14-17(15)12(2,3)4)10-16-18(8,9)13(5,6)7/h10H2,1-9H3/b14-11+/t17-/m0/s1 |
| InChIKey | UPRRUUGLNYSULF-WKOYGUFESA-N |
| XLogP | 3.93 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|