C14H31NO2SSi — CID 150420736
(R)-N-[3-[tert-butyl(dimethyl)silyl]oxybutylidene]-2-methylpropane-2-sulfinamide (PubChem CID 150420736) has the molecular formula C14H31NO2SSi and a molecular weight of 305.56 g/mol. Its IUPAC name is (R)-N-[3-[tert-butyl(dimethyl)silyl]oxybutylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[3-[tert-butyl(dimethyl)silyl]oxybutylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 150420736 |
| Molecular Formula | C14H31NO2SSi |
| Molecular Weight | 305.56 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | (R)-N-[3-[tert-butyl(dimethyl)silyl]oxybutylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(CC=N[S@](=O)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H31NO2SSi/c1-12(17-19(8,9)14(5,6)7)10-11-15-18(16)13(2,3)4/h11-12H,10H2,1-9H3/t12?,18-/m1/s1 |
| InChIKey | HHSNBYWXVXONAM-VMHBGOFLSA-N |
| XLogP | 4.32 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|