C17H35NO2SSi — CID 172726101
(R)-N-[2-[1-[tert-butyl(dimethyl)silyl]oxycyclopentyl]ethylidene]-2-methylpropane-2-sulfinamide (PubChem CID 172726101) has the molecular formula C17H35NO2SSi and a molecular weight of 345.63 g/mol. Its IUPAC name is (R)-N-[2-[1-[tert-butyl(dimethyl)silyl]oxycyclopentyl]ethylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[2-[1-[tert-butyl(dimethyl)silyl]oxycyclopentyl]ethylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 172726101 |
| Molecular Formula | C17H35NO2SSi |
| Molecular Weight | 345.63 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | (R)-N-[2-[1-[tert-butyl(dimethyl)silyl]oxycyclopentyl]ethylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N=CCC1(O[Si](C)(C)C(C)(C)C)CCCC1 |
| InChI | InChI=1S/C17H35NO2SSi/c1-15(2,3)21(19)18-14-13-17(11-9-10-12-17)20-22(7,8)16(4,5)6/h14H,9-13H2,1-8H3/t21-/m1/s1 |
| InChIKey | HEBNLEJRQKXKAA-OAQYLSRUSA-N |
| XLogP | 5.24 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.63 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|