C16H33NO2SSi — CID 67305445
N-[2-[1-[tert-butyl(dimethyl)silyl]oxycyclobutyl]ethylidene]-2-methylpropane-2-sulfinamide (PubChem CID 67305445) has the molecular formula C16H33NO2SSi and a molecular weight of 331.60 g/mol. Its IUPAC name is N-[2-[1-[tert-butyl(dimethyl)silyl]oxycyclobutyl]ethylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[2-[1-[tert-butyl(dimethyl)silyl]oxycyclobutyl]ethylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 67305445 |
| Molecular Formula | C16H33NO2SSi |
| Molecular Weight | 331.60 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | N-[2-[1-[tert-butyl(dimethyl)silyl]oxycyclobutyl]ethylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)N=CCC1(O[Si](C)(C)C(C)(C)C)CCC1 |
| InChI | InChI=1S/C16H33NO2SSi/c1-14(2,3)20(18)17-13-12-16(10-9-11-16)19-21(7,8)15(4,5)6/h13H,9-12H2,1-8H3 |
| InChIKey | LAJMUCNVLPHHFE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|