C14H25NO2Si — CID 125449778
cis-(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-(2-oxoethyl)cyclopentane-1-carbonitrile (PubChem CID 125449778) has the molecular formula C14H25NO2Si and a molecular weight of 267.44 g/mol. Its IUPAC name is cis-(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-(2-oxoethyl)cyclopentane-1-carbonitrile.
| Compound Name | cis-(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-(2-oxoethyl)cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 125449778 |
| Molecular Formula | C14H25NO2Si |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | cis-(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-(2-oxoethyl)cyclopentane-1-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)O[C@]1(CC=O)CC[C@@H](C#N)C1 |
| InChI | InChI=1S/C14H25NO2Si/c1-13(2,3)18(4,5)17-14(8-9-16)7-6-12(10-14)11-15/h9,12H,6-8,10H2,1-5H3/t12-,14+/m1/s1 |
| InChIKey | LHARDQLUVQXEMQ-OCCSQVGLSA-N |
| XLogP | 3.66 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|