C16H28NO2PS — CID 135006095
(S)-N-[(1R)-1-diethylphosphoryl-1-phenylethyl]-2-methylpropane-2-sulfinamide (PubChem CID 135006095) has the molecular formula C16H28NO2PS and a molecular weight of 329.45 g/mol. Its IUPAC name is (S)-N-[(1R)-1-diethylphosphoryl-1-phenylethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(1R)-1-diethylphosphoryl-1-phenylethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 135006095 |
| Molecular Formula | C16H28NO2PS |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (S)-N-[(1R)-1-diethylphosphoryl-1-phenylethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CCP(=O)(CC)[C@@](C)(N[S@@](=O)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H28NO2PS/c1-7-20(18,8-2)16(6,14-12-10-9-11-13-14)17-21(19)15(3,4)5/h9-13,17H,7-8H2,1-6H3/t16-,21+/m1/s1 |
| InChIKey | SNAKJZSYDOJYDU-IERDGZPVSA-N |
| XLogP | 4.31 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|