About (R)-2-methyl-N-[(1R)-2,2,2-trifluoro-1-isocyano-1-phenylethyl]propane-2-sulfinamide
(R)-2-methyl-N-[(1R)-2,2,2-trifluoro-1-isocyano-1-phenylethyl]propane-2-sulfinamide (PubChem CID 134996941) has the molecular formula C13H15F3N2OS
and a molecular weight of 304.34 g/mol. Its IUPAC name is (R)-2-methyl-N-[(1R)-2,2,2-trifluoro-1-isocyano-1-phenylethyl]propane-2-sulfinamide.
Molecular Properties
| Compound Name | (R)-2-methyl-N-[(1R)-2,2,2-trifluoro-1-isocyano-1-phenylethyl]propane-2-sulfinamide |
| PubChem CID | 134996941 |
| Molecular Formula | C13H15F3N2OS |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | (R)-2-methyl-N-[(1R)-2,2,2-trifluoro-1-isocyano-1-phenylethyl]propane-2-sulfinamide |
| SMILES | [C-]#[N+][C@@](N[S@](=O)C(C)(C)C)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H15F3N2OS/c1-11(2,3)20(19)18-12(17-4,13(14,15)16)10-8-6-5-7-9-10/h5-9,18H,1-3H3/t12-,20-/m1/s1 |
| InChIKey | SLGAFBOCFOGCEE-MPBGBICISA-N |
| XLogP | 3.37 |
| TPSA | 33.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (R)-2-methyl-N-[(1R)-2,2,2-trifluoro-1-isocyano-1-phenylethyl]propane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-2-methyl-N-[(1R)-2,2,2-trifluoro-1-isocyano-1-phenylethyl]propane-2-sulfinamide?
The IUPAC name of (R)-2-methyl-N-[(1R)-2,2,2-trifluoro-1-isocyano-1-phenylethyl]propane-2-sulfinamide (CID 134996941) is (R)-2-methyl-N-[(1R)-2,2,2-trifluoro-1-isocyano-1-phenylethyl]propane-2-sulfinamide.
What is the SMILES notation for (R)-2-methyl-N-[(1R)-2,2,2-trifluoro-1-isocyano-1-phenylethyl]propane-2-sulfinamide?
The canonical SMILES for (R)-2-methyl-N-[(1R)-2,2,2-trifluoro-1-isocyano-1-phenylethyl]propane-2-sulfinamide is [C-]#[N+][C@@](N[S@](=O)C(C)(C)C)(c1ccccc1)C(F)(F)F.
What is the InChIKey of (R)-2-methyl-N-[(1R)-2,2,2-trifluoro-1-isocyano-1-phenylethyl]propane-2-sulfinamide?
The InChIKey is SLGAFBOCFOGCEE-MPBGBICISA-N. The full InChI is InChI=1S/C13H15F3N2OS/c1-11(2,3)20(19)18-12(17-4,13(14,15)16)10-8-6-5-7-9-10/h5-9,18H,1-3H3/t12-,20-/m1/s1.
What are the key properties of (R)-2-methyl-N-[(1R)-2,2,2-trifluoro-1-isocyano-1-phenylethyl]propane-2-sulfinamide?
(R)-2-methyl-N-[(1R)-2,2,2-trifluoro-1-isocyano-1-phenylethyl]propane-2-sulfinamide has a molecular weight of 304.34 g/mol, XLogP of 3.37, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-2-methyl-N-[(1R)-2,2,2-trifluoro-1-isocyano-1-phenylethyl]propane-2-sulfinamide is sourced from PubChem (CID 134996941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).