C23H28F3NOS — CID 163849727
(S)-2-methyl-N-[(E,2R)-1,1,1-trifluoro-2,7-diphenylhept-3-en-2-yl]propane-2-sulfinamide (PubChem CID 163849727) has the molecular formula C23H28F3NOS and a molecular weight of 423.54 g/mol. Its IUPAC name is (S)-2-methyl-N-[(E,2R)-1,1,1-trifluoro-2,7-diphenylhept-3-en-2-yl]propane-2-sulfinamide.
| Compound Name | (S)-2-methyl-N-[(E,2R)-1,1,1-trifluoro-2,7-diphenylhept-3-en-2-yl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 163849727 |
| Molecular Formula | C23H28F3NOS |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | (S)-2-methyl-N-[(E,2R)-1,1,1-trifluoro-2,7-diphenylhept-3-en-2-yl]propane-2-sulfinamide |
| SMILES | CC(C)(C)[S@](=O)N[C@](/C=C/CCCc1ccccc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C23H28F3NOS/c1-21(2,3)29(28)27-22(23(24,25)26,20-16-10-5-11-17-20)18-12-6-9-15-19-13-7-4-8-14-19/h4-5,7-8,10-14,16-18,27H,6,9,15H2,1-3H3/b18-12+/t22-,29+/m1/s1 |
| InChIKey | OTHWCFYREFKTSZ-IWNMQKBKSA-N |
| XLogP | 6.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|