C25H36BNO3S — CID 71812840
(R)-N-[(1S)-1,3-diphenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-2-methylpropane-2-sulfinamide (PubChem CID 71812840) has the molecular formula C25H36BNO3S and a molecular weight of 441.45 g/mol. Its IUPAC name is (R)-N-[(1S)-1,3-diphenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(1S)-1,3-diphenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 71812840 |
| Molecular Formula | C25H36BNO3S |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | (R)-N-[(1S)-1,3-diphenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N[C@](CCc1ccccc1)(B1OC(C)(C)C(C)(C)O1)c1ccccc1 |
| InChI | InChI=1S/C25H36BNO3S/c1-22(2,3)31(28)27-25(21-16-12-9-13-17-21,19-18-20-14-10-8-11-15-20)26-29-23(4,5)24(6,7)30-26/h8-17,27H,18-19H2,1-7H3/t25-,31+/m0/s1 |
| InChIKey | QPUHSXRWRLNKBQ-VVFBEHOQSA-N |
| XLogP | 5.20 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|