C23H31BO2 — CID 132567785
2-(2,3-diphenylpentan-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 132567785) has the molecular formula C23H31BO2 and a molecular weight of 350.31 g/mol. Its IUPAC name is 2-(2,3-diphenylpentan-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(2,3-diphenylpentan-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 132567785 |
| Molecular Formula | C23H31BO2 |
| Molecular Weight | 350.31 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 2-(2,3-diphenylpentan-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCC(c1ccccc1)C(C)(B1OC(C)(C)C(C)(C)O1)c1ccccc1 |
| InChI | InChI=1S/C23H31BO2/c1-7-20(18-14-10-8-11-15-18)23(6,19-16-12-9-13-17-19)24-25-21(2,3)22(4,5)26-24/h8-17,20H,7H2,1-6H3 |
| InChIKey | JOCIHNUVRVYZHY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.31 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|