C19H32BNO2 — CID 132503896
N,N-dimethyl-3-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-1-amine (PubChem CID 132503896) has the molecular formula C19H32BNO2 and a molecular weight of 317.28 g/mol. Its IUPAC name is N,N-dimethyl-3-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-1-amine.
| Compound Name | N,N-dimethyl-3-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-1-amine |
|---|---|
| PubChem CID | 132503896 |
| Molecular Formula | C19H32BNO2 |
| Molecular Weight | 317.28 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | N,N-dimethyl-3-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-1-amine |
| SMILES | CCC(CCN(C)C)(B1OC(C)(C)C(C)(C)O1)c1ccccc1 |
| InChI | InChI=1S/C19H32BNO2/c1-8-19(14-15-21(6)7,16-12-10-9-11-13-16)20-22-17(2,3)18(4,5)23-20/h9-13H,8,14-15H2,1-7H3 |
| InChIKey | RQLXTCDEUVYRKN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.28 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|