C24H31BO2 — CID 102579217
2-[(Z,3S)-3,6-diphenylhex-5-en-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 102579217) has the molecular formula C24H31BO2 and a molecular weight of 362.32 g/mol. Its IUPAC name is 2-[(Z,3S)-3,6-diphenylhex-5-en-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(Z,3S)-3,6-diphenylhex-5-en-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 102579217 |
| Molecular Formula | C24H31BO2 |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 2-[(Z,3S)-3,6-diphenylhex-5-en-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC[C@](C/C=C\c1ccccc1)(B1OC(C)(C)C(C)(C)O1)c1ccccc1 |
| InChI | InChI=1S/C24H31BO2/c1-6-24(21-17-11-8-12-18-21,19-13-16-20-14-9-7-10-15-20)25-26-22(2,3)23(4,5)27-25/h7-18H,6,19H2,1-5H3/b16-13-/t24-/m1/s1 |
| InChIKey | UKXGFQXUSZSEJH-ODTUPPAISA-N |
| XLogP | 6.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|