C13H18S3 — CID 15833819
[(E)-4,4,4-tris(methylsulfanyl)but-1-enyl]benzene (PubChem CID 15833819) has the molecular formula C13H18S3 and a molecular weight of 270.49 g/mol. Its IUPAC name is [(E)-4,4,4-tris(methylsulfanyl)but-1-enyl]benzene.
| Compound Name | [(E)-4,4,4-tris(methylsulfanyl)but-1-enyl]benzene |
|---|---|
| PubChem CID | 15833819 |
| Molecular Formula | C13H18S3 |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | [(E)-4,4,4-tris(methylsulfanyl)but-1-enyl]benzene |
| SMILES | CSC(C/C=C/c1ccccc1)(SC)SC |
| InChI | InChI=1S/C13H18S3/c1-14-13(15-2,16-3)11-7-10-12-8-5-4-6-9-12/h4-10H,11H2,1-3H3/b10-7+ |
| InChIKey | ACJJCINWRHPJBT-JXMROGBWSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|