C17H26O2 — CID 19985308
[(E)-4,4-bis(methoxymethyl)-5-methylhex-1-enyl]benzene (PubChem CID 19985308) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is [(E)-4,4-bis(methoxymethyl)-5-methylhex-1-enyl]benzene.
| Compound Name | [(E)-4,4-bis(methoxymethyl)-5-methylhex-1-enyl]benzene |
|---|---|
| PubChem CID | 19985308 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | [(E)-4,4-bis(methoxymethyl)-5-methylhex-1-enyl]benzene |
| SMILES | COCC(C/C=C/c1ccccc1)(COC)C(C)C |
| InChI | InChI=1S/C17H26O2/c1-15(2)17(13-18-3,14-19-4)12-8-11-16-9-6-5-7-10-16/h5-11,15H,12-14H2,1-4H3/b11-8+ |
| InChIKey | PBUBWLKNWNWWGC-DHZHZOJOSA-N |
| XLogP | 4.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |