C18H21NO2 — CID 54028396
[3-(dimethylamino)-1,1-diphenylpropyl] formate (PubChem CID 54028396) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is [3-(dimethylamino)-1,1-diphenylpropyl] formate.
| Compound Name | [3-(dimethylamino)-1,1-diphenylpropyl] formate |
|---|---|
| PubChem CID | 54028396 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | [3-(dimethylamino)-1,1-diphenylpropyl] formate |
| SMILES | CN(C)CCC(OC=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21NO2/c1-19(2)14-13-18(21-15-20,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,15H,13-14H2,1-2H3 |
| InChIKey | RCCNOMZZIIULSU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|