C19H23NO — CID 88611833
5-(dimethylamino)-2,2-diphenylpentanal (PubChem CID 88611833) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is 5-(dimethylamino)-2,2-diphenylpentanal.
| Compound Name | 5-(dimethylamino)-2,2-diphenylpentanal |
|---|---|
| PubChem CID | 88611833 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 5-(dimethylamino)-2,2-diphenylpentanal |
| SMILES | CN(C)CCCC(C=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H23NO/c1-20(2)15-9-14-19(16-21,17-10-5-3-6-11-17)18-12-7-4-8-13-18/h3-8,10-13,16H,9,14-15H2,1-2H3 |
| InChIKey | BNXMTLNWDZISCG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|