C16H27NO — CID 11834795
6-(dimethylamino)-2,3-dimethyl-2-phenylhexan-3-ol (PubChem CID 11834795) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is 6-(dimethylamino)-2,3-dimethyl-2-phenylhexan-3-ol.
| Compound Name | 6-(dimethylamino)-2,3-dimethyl-2-phenylhexan-3-ol |
|---|---|
| PubChem CID | 11834795 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 6-(dimethylamino)-2,3-dimethyl-2-phenylhexan-3-ol |
| SMILES | CN(C)CCCC(C)(O)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C16H27NO/c1-15(2,14-10-7-6-8-11-14)16(3,18)12-9-13-17(4)5/h6-8,10-11,18H,9,12-13H2,1-5H3 |
| InChIKey | PHYAOSLAMQIOAR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |