About CID 19591298
CID 19591298 (PubChem CID 19591298) has the molecular formula C15H15BO
and a molecular weight of 222.10 g/mol.
Molecular Properties
| Compound Name | CID 19591298 |
| PubChem CID | 19591298 |
| Molecular Formula | C15H15BO |
| Molecular Weight | 222.10 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | — |
| SMILES | [B]OC(CC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H15BO/c1-2-15(17-16,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,2H2,1H3 |
| InChIKey | CZYCQFBYZZNQQS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.10 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 19591298 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 19591298?
The IUPAC name of CID 19591298 (CID 19591298) is not available.
What is the SMILES notation for CID 19591298?
The canonical SMILES for CID 19591298 is [B]OC(CC)(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 19591298?
The InChIKey is CZYCQFBYZZNQQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15BO/c1-2-15(17-16,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,2H2,1H3.
What are the key properties of CID 19591298?
CID 19591298 has a molecular weight of 222.10 g/mol, XLogP of 3.44, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 19591298 is sourced from PubChem (CID 19591298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).