C31H28O4 — CID 19753165
1,1-diphenylpropyl 3-formyloxy-3,3-diphenylpropanoate (PubChem CID 19753165) has the molecular formula C31H28O4 and a molecular weight of 464.56 g/mol. Its IUPAC name is 1,1-diphenylpropyl 3-formyloxy-3,3-diphenylpropanoate.
| Compound Name | 1,1-diphenylpropyl 3-formyloxy-3,3-diphenylpropanoate |
|---|---|
| PubChem CID | 19753165 |
| Molecular Formula | C31H28O4 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 1,1-diphenylpropyl 3-formyloxy-3,3-diphenylpropanoate |
| SMILES | CCC(OC(=O)CC(OC=O)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H28O4/c1-2-30(25-15-7-3-8-16-25,26-17-9-4-10-18-26)35-29(33)23-31(34-24-32,27-19-11-5-12-20-27)28-21-13-6-14-22-28/h3-22,24H,2,23H2,1H3 |
| InChIKey | TYQLWRQKTBOPCV-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|