C26H28N2O3 — CID 87405254
1,1-diphenylpropyl N-amino-N-(1-oxo-4-phenylbutan-2-yl)carbamate (PubChem CID 87405254) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is 1,1-diphenylpropyl N-amino-N-(1-oxo-4-phenylbutan-2-yl)carbamate.
| Compound Name | 1,1-diphenylpropyl N-amino-N-(1-oxo-4-phenylbutan-2-yl)carbamate |
|---|---|
| PubChem CID | 87405254 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 1,1-diphenylpropyl N-amino-N-(1-oxo-4-phenylbutan-2-yl)carbamate |
| SMILES | CCC(OC(=O)N(N)C(C=O)CCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H28N2O3/c1-2-26(22-14-8-4-9-15-22,23-16-10-5-11-17-23)31-25(30)28(27)24(20-29)19-18-21-12-6-3-7-13-21/h3-17,20,24H,2,18-19,27H2,1H3 |
| InChIKey | ZNKNQIXETLAKLS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|