C20H24O3 — CID 174801671
2-(1,1-diphenylpropoxy)ethyl propanoate (PubChem CID 174801671) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-(1,1-diphenylpropoxy)ethyl propanoate.
| Compound Name | 2-(1,1-diphenylpropoxy)ethyl propanoate |
|---|---|
| PubChem CID | 174801671 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 2-(1,1-diphenylpropoxy)ethyl propanoate |
| SMILES | CCC(=O)OCCOC(CC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H24O3/c1-3-19(21)22-15-16-23-20(4-2,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14H,3-4,15-16H2,1-2H3 |
| InChIKey | RYIBHMVWAOTOKJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|