About (3-ethyl-3-phenylpentyl) acetate
(3-ethyl-3-phenylpentyl) acetate (PubChem CID 142276896) has the molecular formula C15H22O2
and a molecular weight of 234.34 g/mol. Its IUPAC name is (3-ethyl-3-phenylpentyl) acetate.
Molecular Properties
| Compound Name | (3-ethyl-3-phenylpentyl) acetate |
| PubChem CID | 142276896 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (3-ethyl-3-phenylpentyl) acetate |
| SMILES | CCC(CC)(CCOC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C15H22O2/c1-4-15(5-2,11-12-17-13(3)16)14-9-7-6-8-10-14/h6-10H,4-5,11-12H2,1-3H3 |
| InChIKey | HQKBBHDBDWVKRV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-ethyl-3-phenylpentyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethyl-3-phenylpentyl) acetate?
The IUPAC name of (3-ethyl-3-phenylpentyl) acetate (CID 142276896) is (3-ethyl-3-phenylpentyl) acetate.
What is the SMILES notation for (3-ethyl-3-phenylpentyl) acetate?
The canonical SMILES for (3-ethyl-3-phenylpentyl) acetate is CCC(CC)(CCOC(C)=O)c1ccccc1.
What is the InChIKey of (3-ethyl-3-phenylpentyl) acetate?
The InChIKey is HQKBBHDBDWVKRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O2/c1-4-15(5-2,11-12-17-13(3)16)14-9-7-6-8-10-14/h6-10H,4-5,11-12H2,1-3H3.
What are the key properties of (3-ethyl-3-phenylpentyl) acetate?
(3-ethyl-3-phenylpentyl) acetate has a molecular weight of 234.34 g/mol, XLogP of 3.70, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethyl-3-phenylpentyl) acetate is sourced from PubChem (CID 142276896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).