About [2-(hydroxymethyl)-2-phenylbutyl] N-aminocarbamate
[2-(hydroxymethyl)-2-phenylbutyl] N-aminocarbamate (PubChem CID 131876760) has the molecular formula C12H18N2O3
and a molecular weight of 238.29 g/mol. Its IUPAC name is [2-(hydroxymethyl)-2-phenylbutyl] N-aminocarbamate.
Molecular Properties
| Compound Name | [2-(hydroxymethyl)-2-phenylbutyl] N-aminocarbamate |
| PubChem CID | 131876760 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | [2-(hydroxymethyl)-2-phenylbutyl] N-aminocarbamate |
| SMILES | CCC(CO)(COC(=O)NN)c1ccccc1 |
| InChI | InChI=1S/C12H18N2O3/c1-2-12(8-15,9-17-11(16)14-13)10-6-4-3-5-7-10/h3-7,15H,2,8-9,13H2,1H3,(H,14,16) |
| InChIKey | CYGCMJYBVQPRLT-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(hydroxymethyl)-2-phenylbutyl] N-aminocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(hydroxymethyl)-2-phenylbutyl] N-aminocarbamate?
The IUPAC name of [2-(hydroxymethyl)-2-phenylbutyl] N-aminocarbamate (CID 131876760) is [2-(hydroxymethyl)-2-phenylbutyl] N-aminocarbamate.
What is the SMILES notation for [2-(hydroxymethyl)-2-phenylbutyl] N-aminocarbamate?
The canonical SMILES for [2-(hydroxymethyl)-2-phenylbutyl] N-aminocarbamate is CCC(CO)(COC(=O)NN)c1ccccc1.
What is the InChIKey of [2-(hydroxymethyl)-2-phenylbutyl] N-aminocarbamate?
The InChIKey is CYGCMJYBVQPRLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O3/c1-2-12(8-15,9-17-11(16)14-13)10-6-4-3-5-7-10/h3-7,15H,2,8-9,13H2,1H3,(H,14,16).
What are the key properties of [2-(hydroxymethyl)-2-phenylbutyl] N-aminocarbamate?
[2-(hydroxymethyl)-2-phenylbutyl] N-aminocarbamate has a molecular weight of 238.29 g/mol, XLogP of 0.93, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(hydroxymethyl)-2-phenylbutyl] N-aminocarbamate is sourced from PubChem (CID 131876760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).