C18H18FNO4 — CID 141174730
(2-acetyloxyethylamino) 2-fluoro-2,2-diphenylacetate (PubChem CID 141174730) has the molecular formula C18H18FNO4 and a molecular weight of 331.34 g/mol. Its IUPAC name is (2-acetyloxyethylamino) 2-fluoro-2,2-diphenylacetate.
| Compound Name | (2-acetyloxyethylamino) 2-fluoro-2,2-diphenylacetate |
|---|---|
| PubChem CID | 141174730 |
| Molecular Formula | C18H18FNO4 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (2-acetyloxyethylamino) 2-fluoro-2,2-diphenylacetate |
| SMILES | CC(=O)OCCNOC(=O)C(F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H18FNO4/c1-14(21)23-13-12-20-24-17(22)18(19,15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,20H,12-13H2,1H3 |
| InChIKey | FOKUHYJHTLTQLI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|