C24H22BrFO3 — CID 24757560
bromomethane;[(E)-3-hydroxy-2-phenylprop-2-enyl] 2-fluoro-2,2-diphenylacetate (PubChem CID 24757560) has the molecular formula C24H22BrFO3 and a molecular weight of 457.34 g/mol. Its IUPAC name is bromomethane;[(E)-3-hydroxy-2-phenylprop-2-enyl] 2-fluoro-2,2-diphenylacetate.
| Compound Name | bromomethane;[(E)-3-hydroxy-2-phenylprop-2-enyl] 2-fluoro-2,2-diphenylacetate |
|---|---|
| PubChem CID | 24757560 |
| Molecular Formula | C24H22BrFO3 |
| Molecular Weight | 457.34 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | bromomethane;[(E)-3-hydroxy-2-phenylprop-2-enyl] 2-fluoro-2,2-diphenylacetate |
| SMILES | CBr.O=C(OC/C(=C/O)c1ccccc1)C(F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H19FO3.CH3Br/c24-23(20-12-6-2-7-13-20,21-14-8-3-9-15-21)22(26)27-17-19(16-25)18-10-4-1-5-11-18;1-2/h1-16,25H,17H2;1H3/b19-16-; |
| InChIKey | YCQMLVFAGULLHQ-JWJVXZKMSA-N |
| XLogP | 6.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.34 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|