About [(E)-2-phenylbut-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]acetate
[(E)-2-phenylbut-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]acetate (PubChem CID 53355401) has the molecular formula C14H14F3NO3
and a molecular weight of 301.26 g/mol. Its IUPAC name is [(E)-2-phenylbut-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]acetate.
Molecular Properties
| Compound Name | [(E)-2-phenylbut-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]acetate |
| PubChem CID | 53355401 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | [(E)-2-phenylbut-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]acetate |
| SMILES | C/C=C(/COC(=O)CNC(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H14F3NO3/c1-2-10(11-6-4-3-5-7-11)9-21-12(19)8-18-13(20)14(15,16)17/h2-7H,8-9H2,1H3,(H,18,20)/b10-2- |
| InChIKey | FXWNILDTCGXIFD-SGAXSIHGSA-N |
| XLogP | 2.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(E)-2-phenylbut-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-2-phenylbut-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]acetate?
The IUPAC name of [(E)-2-phenylbut-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]acetate (CID 53355401) is [(E)-2-phenylbut-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]acetate.
What is the SMILES notation for [(E)-2-phenylbut-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]acetate?
The canonical SMILES for [(E)-2-phenylbut-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]acetate is C/C=C(/COC(=O)CNC(=O)C(F)(F)F)c1ccccc1.
What is the InChIKey of [(E)-2-phenylbut-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]acetate?
The InChIKey is FXWNILDTCGXIFD-SGAXSIHGSA-N. The full InChI is InChI=1S/C14H14F3NO3/c1-2-10(11-6-4-3-5-7-11)9-21-12(19)8-18-13(20)14(15,16)17/h2-7H,8-9H2,1H3,(H,18,20)/b10-2-.
What are the key properties of [(E)-2-phenylbut-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]acetate?
[(E)-2-phenylbut-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]acetate has a molecular weight of 301.26 g/mol, XLogP of 2.31, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-2-phenylbut-2-enyl] 2-[(2,2,2-trifluoroacetyl)amino]acetate is sourced from PubChem (CID 53355401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).