C25H18F6O4 — CID 89258515
(3-hydroxy-2-phenylprop-2-enyl) 2-hydroxy-2,2-bis[4-(trifluoromethyl)phenyl]acetate (PubChem CID 89258515) has the molecular formula C25H18F6O4 and a molecular weight of 496.40 g/mol. Its IUPAC name is (3-hydroxy-2-phenylprop-2-enyl) 2-hydroxy-2,2-bis[4-(trifluoromethyl)phenyl]acetate.
| Compound Name | (3-hydroxy-2-phenylprop-2-enyl) 2-hydroxy-2,2-bis[4-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 89258515 |
| Molecular Formula | C25H18F6O4 |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | (3-hydroxy-2-phenylprop-2-enyl) 2-hydroxy-2,2-bis[4-(trifluoromethyl)phenyl]acetate |
| SMILES | O=C(OCC(=CO)c1ccccc1)C(O)(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H18F6O4/c26-24(27,28)20-10-6-18(7-11-20)23(34,19-8-12-21(13-9-19)25(29,30)31)22(33)35-15-17(14-32)16-4-2-1-3-5-16/h1-14,32,34H,15H2 |
| InChIKey | FUQOGDNHOHRMEQ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|