About (1-ethoxy-1-phenylpropyl)benzene;3-phenylpentan-3-ol
(1-ethoxy-1-phenylpropyl)benzene;3-phenylpentan-3-ol (PubChem CID 67792118) has the molecular formula C28H36O2
and a molecular weight of 404.59 g/mol. Its IUPAC name is (1-ethoxy-1-phenylpropyl)benzene;3-phenylpentan-3-ol.
Molecular Properties
| Compound Name | (1-ethoxy-1-phenylpropyl)benzene;3-phenylpentan-3-ol |
| PubChem CID | 67792118 |
| Molecular Formula | C28H36O2 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | (1-ethoxy-1-phenylpropyl)benzene;3-phenylpentan-3-ol |
| SMILES | CCC(O)(CC)c1ccccc1.CCOC(CC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20O.C11H16O/c1-3-17(18-4-2,15-11-7-5-8-12-15)16-13-9-6-10-14-16;1-3-11(12,4-2)10-8-6-5-7-9-10/h5-14H,3-4H2,1-2H3;5-9,12H,3-4H2,1-2H3 |
| InChIKey | JYGHGTKBSZLZJN-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-ethoxy-1-phenylpropyl)benzene;3-phenylpentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethoxy-1-phenylpropyl)benzene;3-phenylpentan-3-ol?
The IUPAC name of (1-ethoxy-1-phenylpropyl)benzene;3-phenylpentan-3-ol (CID 67792118) is (1-ethoxy-1-phenylpropyl)benzene;3-phenylpentan-3-ol.
What is the SMILES notation for (1-ethoxy-1-phenylpropyl)benzene;3-phenylpentan-3-ol?
The canonical SMILES for (1-ethoxy-1-phenylpropyl)benzene;3-phenylpentan-3-ol is CCC(O)(CC)c1ccccc1.CCOC(CC)(c1ccccc1)c1ccccc1.
What is the InChIKey of (1-ethoxy-1-phenylpropyl)benzene;3-phenylpentan-3-ol?
The InChIKey is JYGHGTKBSZLZJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O.C11H16O/c1-3-17(18-4-2,15-11-7-5-8-12-15)16-13-9-6-10-14-16;1-3-11(12,4-2)10-8-6-5-7-9-10/h5-14H,3-4H2,1-2H3;5-9,12H,3-4H2,1-2H3.
What are the key properties of (1-ethoxy-1-phenylpropyl)benzene;3-phenylpentan-3-ol?
(1-ethoxy-1-phenylpropyl)benzene;3-phenylpentan-3-ol has a molecular weight of 404.59 g/mol, XLogP of 7.07, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethoxy-1-phenylpropyl)benzene;3-phenylpentan-3-ol is sourced from PubChem (CID 67792118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).