C10H15NO4S — CID 88672538
(2-hydroxy-2-phenylbutyl) sulfamate (PubChem CID 88672538) has the molecular formula C10H15NO4S and a molecular weight of 245.30 g/mol. Its IUPAC name is (2-hydroxy-2-phenylbutyl) sulfamate.
| Compound Name | (2-hydroxy-2-phenylbutyl) sulfamate |
|---|---|
| PubChem CID | 88672538 |
| Molecular Formula | C10H15NO4S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | (2-hydroxy-2-phenylbutyl) sulfamate |
| SMILES | CCC(O)(COS(N)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C10H15NO4S/c1-2-10(12,8-15-16(11,13)14)9-6-4-3-5-7-9/h3-7,12H,2,8H2,1H3,(H2,11,13,14) |
| InChIKey | PSKXPNNGFIBRCW-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |