C11H17NO3S — CID 122528733
(2,2-dimethyl-3-phenylpropyl) sulfamate (PubChem CID 122528733) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is (2,2-dimethyl-3-phenylpropyl) sulfamate.
| Compound Name | (2,2-dimethyl-3-phenylpropyl) sulfamate |
|---|---|
| PubChem CID | 122528733 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | (2,2-dimethyl-3-phenylpropyl) sulfamate |
| SMILES | CC(C)(COS(N)(=O)=O)Cc1ccccc1 |
| InChI | InChI=1S/C11H17NO3S/c1-11(2,9-15-16(12,13)14)8-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3,(H2,12,13,14) |
| InChIKey | MYSCYJMIXWBKMQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |