About azane;ethyl 3-benzylpentane-3-sulfonate
azane;ethyl 3-benzylpentane-3-sulfonate (PubChem CID 174743200) has the molecular formula C14H28N2O3S
and a molecular weight of 304.46 g/mol. Its IUPAC name is azane;ethyl 3-benzylpentane-3-sulfonate.
Molecular Properties
| Compound Name | azane;ethyl 3-benzylpentane-3-sulfonate |
| PubChem CID | 174743200 |
| Molecular Formula | C14H28N2O3S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | azane;ethyl 3-benzylpentane-3-sulfonate |
| SMILES | CCOS(=O)(=O)C(CC)(CC)Cc1ccccc1.N.N |
| InChI | InChI=1S/C14H22O3S.2H3N/c1-4-14(5-2,18(15,16)17-6-3)12-13-10-8-7-9-11-13;;/h7-11H,4-6,12H2,1-3H3;2*1H3 |
| InChIKey | BAHQIPGWGNWGNT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze azane;ethyl 3-benzylpentane-3-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;ethyl 3-benzylpentane-3-sulfonate?
The IUPAC name of azane;ethyl 3-benzylpentane-3-sulfonate (CID 174743200) is azane;ethyl 3-benzylpentane-3-sulfonate.
What is the SMILES notation for azane;ethyl 3-benzylpentane-3-sulfonate?
The canonical SMILES for azane;ethyl 3-benzylpentane-3-sulfonate is CCOS(=O)(=O)C(CC)(CC)Cc1ccccc1.N.N.
What is the InChIKey of azane;ethyl 3-benzylpentane-3-sulfonate?
The InChIKey is BAHQIPGWGNWGNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O3S.2H3N/c1-4-14(5-2,18(15,16)17-6-3)12-13-10-8-7-9-11-13;;/h7-11H,4-6,12H2,1-3H3;2*1H3.
What are the key properties of azane;ethyl 3-benzylpentane-3-sulfonate?
azane;ethyl 3-benzylpentane-3-sulfonate has a molecular weight of 304.46 g/mol, XLogP of 3.48, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;ethyl 3-benzylpentane-3-sulfonate is sourced from PubChem (CID 174743200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).