C13H17F3O — CID 113326695
7,7,7-trifluoro-3-phenylheptan-3-ol (PubChem CID 113326695) has the molecular formula C13H17F3O and a molecular weight of 246.27 g/mol. Its IUPAC name is 7,7,7-trifluoro-3-phenylheptan-3-ol.
| Compound Name | 7,7,7-trifluoro-3-phenylheptan-3-ol |
|---|---|
| PubChem CID | 113326695 |
| Molecular Formula | C13H17F3O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 7,7,7-trifluoro-3-phenylheptan-3-ol |
| SMILES | CCC(O)(CCCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H17F3O/c1-2-12(17,9-6-10-13(14,15)16)11-7-4-3-5-8-11/h3-5,7-8,17H,2,6,9-10H2,1H3 |
| InChIKey | NLUVFDOLWZLHFW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |