About 1-(pentafluoro-λ6-sulfanyl)-2-phenylhexan-2-ol
1-(pentafluoro-λ6-sulfanyl)-2-phenylhexan-2-ol (PubChem CID 155206594) has the molecular formula C12H17F5OS
and a molecular weight of 304.32 g/mol. Its IUPAC name is 1-(pentafluoro-λ6-sulfanyl)-2-phenylhexan-2-ol.
Molecular Properties
| Compound Name | 1-(pentafluoro-λ6-sulfanyl)-2-phenylhexan-2-ol |
| PubChem CID | 155206594 |
| Molecular Formula | C12H17F5OS |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 1-(pentafluoro-λ6-sulfanyl)-2-phenylhexan-2-ol |
| SMILES | CCCCC(O)(CS(F)(F)(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H17F5OS/c1-2-3-9-12(18,10-19(13,14,15,16)17)11-7-5-4-6-8-11/h4-8,18H,2-3,9-10H2,1H3 |
| InChIKey | AQZOFNUGMJHLRO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(pentafluoro-λ6-sulfanyl)-2-phenylhexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(pentafluoro-λ6-sulfanyl)-2-phenylhexan-2-ol?
The IUPAC name of 1-(pentafluoro-λ6-sulfanyl)-2-phenylhexan-2-ol (CID 155206594) is 1-(pentafluoro-λ6-sulfanyl)-2-phenylhexan-2-ol.
What is the SMILES notation for 1-(pentafluoro-λ6-sulfanyl)-2-phenylhexan-2-ol?
The canonical SMILES for 1-(pentafluoro-λ6-sulfanyl)-2-phenylhexan-2-ol is CCCCC(O)(CS(F)(F)(F)(F)F)c1ccccc1.
What is the InChIKey of 1-(pentafluoro-λ6-sulfanyl)-2-phenylhexan-2-ol?
The InChIKey is AQZOFNUGMJHLRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F5OS/c1-2-3-9-12(18,10-19(13,14,15,16)17)11-7-5-4-6-8-11/h4-8,18H,2-3,9-10H2,1H3.
What are the key properties of 1-(pentafluoro-λ6-sulfanyl)-2-phenylhexan-2-ol?
1-(pentafluoro-λ6-sulfanyl)-2-phenylhexan-2-ol has a molecular weight of 304.32 g/mol, XLogP of 5.36, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(pentafluoro-λ6-sulfanyl)-2-phenylhexan-2-ol is sourced from PubChem (CID 155206594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).