C14H21NO3S — CID 59627207
(3R)-3-(tert-butylsulfinylamino)-3-phenylbutanoic acid (PubChem CID 59627207) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is (3R)-3-(tert-butylsulfinylamino)-3-phenylbutanoic acid.
| Compound Name | (3R)-3-(tert-butylsulfinylamino)-3-phenylbutanoic acid |
|---|---|
| PubChem CID | 59627207 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (3R)-3-(tert-butylsulfinylamino)-3-phenylbutanoic acid |
| SMILES | CC(C)(C)S(=O)N[C@](C)(CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C14H21NO3S/c1-13(2,3)19(18)15-14(4,10-12(16)17)11-8-6-5-7-9-11/h5-9,15H,10H2,1-4H3,(H,16,17)/t14-,19?/m1/s1 |
| InChIKey | PFCRWJKBERQZFO-MJTSIZKDSA-N |
| XLogP | 2.43 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |