C18H31BrN2O3S — CID 90797903
(3S)-3-(3-bromophenyl)-3-[[(R)-tert-butylsulfinyl]amino]-N-methoxy-N-methylbutanamide;ethane (PubChem CID 90797903) has the molecular formula C18H31BrN2O3S and a molecular weight of 435.43 g/mol. Its IUPAC name is (3S)-3-(3-bromophenyl)-3-[[(R)-tert-butylsulfinyl]amino]-N-methoxy-N-methylbutanamide;ethane.
| Compound Name | (3S)-3-(3-bromophenyl)-3-[[(R)-tert-butylsulfinyl]amino]-N-methoxy-N-methylbutanamide;ethane |
|---|---|
| PubChem CID | 90797903 |
| Molecular Formula | C18H31BrN2O3S |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | (3S)-3-(3-bromophenyl)-3-[[(R)-tert-butylsulfinyl]amino]-N-methoxy-N-methylbutanamide;ethane |
| SMILES | CC.CON(C)C(=O)C[C@](C)(N[S@](=O)C(C)(C)C)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H25BrN2O3S.C2H6/c1-15(2,3)23(21)18-16(4,11-14(20)19(5)22-6)12-8-7-9-13(17)10-12;1-2/h7-10,18H,11H2,1-6H3;1-2H3/t16-,23+;/m0./s1 |
| InChIKey | NHKLZOUNZWXLEW-VPRXFHPJSA-N |
| XLogP | 4.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|