C15H23BrN2O3 — CID 87349015
tert-butyl N-[2-(3-bromophenyl)-1-(methoxyamino)propan-2-yl]carbamate (PubChem CID 87349015) has the molecular formula C15H23BrN2O3 and a molecular weight of 359.26 g/mol. Its IUPAC name is tert-butyl N-[2-(3-bromophenyl)-1-(methoxyamino)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-(3-bromophenyl)-1-(methoxyamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 87349015 |
| Molecular Formula | C15H23BrN2O3 |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | tert-butyl N-[2-(3-bromophenyl)-1-(methoxyamino)propan-2-yl]carbamate |
| SMILES | CONCC(C)(NC(=O)OC(C)(C)C)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H23BrN2O3/c1-14(2,3)21-13(19)18-15(4,10-17-20-5)11-7-6-8-12(16)9-11/h6-9,17H,10H2,1-5H3,(H,18,19) |
| InChIKey | ZIMMLEPFAIQOCF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|