C22H27BrClNO2 — CID 91235030
tert-butyl N-[3-(3-bromophenyl)-4-(4-chlorophenyl)-3-methylbutyl]carbamate (PubChem CID 91235030) has the molecular formula C22H27BrClNO2 and a molecular weight of 452.82 g/mol. Its IUPAC name is tert-butyl N-[3-(3-bromophenyl)-4-(4-chlorophenyl)-3-methylbutyl]carbamate.
| Compound Name | tert-butyl N-[3-(3-bromophenyl)-4-(4-chlorophenyl)-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 91235030 |
| Molecular Formula | C22H27BrClNO2 |
| Molecular Weight | 452.82 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | tert-butyl N-[3-(3-bromophenyl)-4-(4-chlorophenyl)-3-methylbutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(C)(Cc1ccc(Cl)cc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C22H27BrClNO2/c1-21(2,3)27-20(26)25-13-12-22(4,17-6-5-7-18(23)14-17)15-16-8-10-19(24)11-9-16/h5-11,14H,12-13,15H2,1-4H3,(H,25,26) |
| InChIKey | CCIUHCFIFXLPAV-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.82 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |