C15H22BrNO3S — CID 66579814
methyl (3S)-3-(3-bromophenyl)-3-(tert-butylsulfinylamino)butanoate (PubChem CID 66579814) has the molecular formula C15H22BrNO3S and a molecular weight of 376.32 g/mol. Its IUPAC name is methyl (3S)-3-(3-bromophenyl)-3-(tert-butylsulfinylamino)butanoate.
| Compound Name | methyl (3S)-3-(3-bromophenyl)-3-(tert-butylsulfinylamino)butanoate |
|---|---|
| PubChem CID | 66579814 |
| Molecular Formula | C15H22BrNO3S |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | methyl (3S)-3-(3-bromophenyl)-3-(tert-butylsulfinylamino)butanoate |
| SMILES | COC(=O)C[C@](C)(NS(=O)C(C)(C)C)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H22BrNO3S/c1-14(2,3)21(19)17-15(4,10-13(18)20-5)11-7-6-8-12(16)9-11/h6-9,17H,10H2,1-5H3/t15-,21?/m0/s1 |
| InChIKey | VWASCVWHZIJNPP-ZDGMYTEDSA-N |
| XLogP | 3.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |