C22H27BrFNO3S — CID 59152402
methyl 5-(2-bromophenyl)-3-(tert-butylsulfinylamino)-3-(3-fluorophenyl)pentanoate (PubChem CID 59152402) has the molecular formula C22H27BrFNO3S and a molecular weight of 484.43 g/mol. Its IUPAC name is methyl 5-(2-bromophenyl)-3-(tert-butylsulfinylamino)-3-(3-fluorophenyl)pentanoate.
| Compound Name | methyl 5-(2-bromophenyl)-3-(tert-butylsulfinylamino)-3-(3-fluorophenyl)pentanoate |
|---|---|
| PubChem CID | 59152402 |
| Molecular Formula | C22H27BrFNO3S |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | methyl 5-(2-bromophenyl)-3-(tert-butylsulfinylamino)-3-(3-fluorophenyl)pentanoate |
| SMILES | COC(=O)CC(CCc1ccccc1Br)(NS(=O)C(C)(C)C)c1cccc(F)c1 |
| InChI | InChI=1S/C22H27BrFNO3S/c1-21(2,3)29(27)25-22(15-20(26)28-4,17-9-7-10-18(24)14-17)13-12-16-8-5-6-11-19(16)23/h5-11,14,25H,12-13,15H2,1-4H3 |
| InChIKey | SBNXVUPYTXWGFR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |