C18H25BrFNO4S — CID 130377125
ethyl (5S)-5-(5-bromo-2-fluorophenyl)-5-[[(R)-tert-butylsulfinyl]amino]-3-oxohexanoate (PubChem CID 130377125) has the molecular formula C18H25BrFNO4S and a molecular weight of 450.37 g/mol. Its IUPAC name is ethyl (5S)-5-(5-bromo-2-fluorophenyl)-5-[[(R)-tert-butylsulfinyl]amino]-3-oxohexanoate.
| Compound Name | ethyl (5S)-5-(5-bromo-2-fluorophenyl)-5-[[(R)-tert-butylsulfinyl]amino]-3-oxohexanoate |
|---|---|
| PubChem CID | 130377125 |
| Molecular Formula | C18H25BrFNO4S |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | ethyl (5S)-5-(5-bromo-2-fluorophenyl)-5-[[(R)-tert-butylsulfinyl]amino]-3-oxohexanoate |
| SMILES | CCOC(=O)CC(=O)C[C@](C)(N[S@](=O)C(C)(C)C)c1cc(Br)ccc1F |
| InChI | InChI=1S/C18H25BrFNO4S/c1-6-25-16(23)10-13(22)11-18(5,21-26(24)17(2,3)4)14-9-12(19)7-8-15(14)20/h7-9,21H,6,10-11H2,1-5H3/t18-,26+/m0/s1 |
| InChIKey | KFNRYCVPFDKWOW-HFJWLAOPSA-N |
| XLogP | 3.77 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|